| Name | Calcium 2-oxoglutarate |
| Synonyms | Calcium 2-oxoglutarate calcium 2-oxopentanedioate Calcium 2-oxopentanedioate α-Ketoglutaric acid calcium salt 2-Oxopentanedioic acid calcium salt alpha-Ketoglutaric Acid Calcium Salt ALPHA-KETOGLUTARATE CALCIUM MONOHYDRATE CALCIUM ALPHA-KETOGLUTARATE MONOHYDRATE Pentanedioic Acid ,2-oxo-,Calcium Salt A-KETOGLUTARIC ACID, CALCIUM SALT, MONOHYDRATE |
| CAS | 71686-01-6 |
| EINECS | 275-843-2 |
| InChI | InChI=1/C5H6O5.Ca/c6-3(5(9)10)1-2-4(7)8;/h1-2H2,(H,7,8)(H,9,10);/q;+2/p-2 |
| Molecular Formula | C5H8CaO5 |
| Molar Mass | 188.19 |
| Melting Point | >300°C (not melting) |
| Boling Point | 345.6°C at 760 mmHg |
| Flash Point | 177°C |
| Solubility | Aqueous Acid (Slightly), Water (Slightly, Heated, Sonicated) |
| Vapor Presure | 1.08E-05mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| Storage Condition | -20°C, Hygroscopic |
| Stability | Hygroscopic |
| In vitro study | Calcium 2-oxoglutarate has other physiological capabilities including reduction of ammonia level formed in the lung and general ammonia detoxification, protective role against lipid peroxidation and neuroprotective effect against cyanide poisoning. Calcium 2-oxoglutarate acts as precursor for the synthesis of amino acids and nucleotides. |
| biological activity | Calcium 2-oxoglutrate is an intermediate in the production of ATP or GTP in the Krebs cycle. Calcium 2-oxoglutrate also serves as the major carbon backbone for nitrogen assimilation reactions. Calcium 2-oxoglutrate is a reversible inhibitor of tyrosinase (IC50=15 mM). |